C8H12BrNO2 — CID 170898987
2-bromo-N-(2-but-3-ynoxyethyl)acetamide (PubChem CID 170898987) has the molecular formula C8H12BrNO2 and a molecular weight of 234.09 g/mol. Its IUPAC name is 2-bromo-N-(2-but-3-ynoxyethyl)acetamide.
| Compound Name | 2-bromo-N-(2-but-3-ynoxyethyl)acetamide |
|---|---|
| PubChem CID | 170898987 |
| Molecular Formula | C8H12BrNO2 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-bromo-N-(2-but-3-ynoxyethyl)acetamide |
| SMILES | C#CCCOCCNC(=O)CBr |
| InChI | InChI=1S/C8H12BrNO2/c1-2-3-5-12-6-4-10-8(11)7-9/h1H,3-7H2,(H,10,11) |
| InChIKey | GEQYAVQSRTXVPQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|