C34H59N5O8 — CID 118673921
N-[2-[bis(3-oxobutyl)amino]ethyl]-3-[[3-[2-[bis(3-oxobutyl)amino]ethylamino]-3-oxopropyl]-[2-(2-but-3-ynoxyethoxy)ethyl]amino]propanamide (PubChem CID 118673921) has the molecular formula C34H59N5O8 and a molecular weight of 665.87 g/mol. Its IUPAC name is N-[2-[bis(3-oxobutyl)amino]ethyl]-3-[[3-[2-[bis(3-oxobutyl)amino]ethylamino]-3-oxopropyl]-[2-(2-but-3-ynoxyethoxy)ethyl]amino]propanamide.
| Compound Name | N-[2-[bis(3-oxobutyl)amino]ethyl]-3-[[3-[2-[bis(3-oxobutyl)amino]ethylamino]-3-oxopropyl]-[2-(2-but-3-ynoxyethoxy)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 118673921 |
| Molecular Formula | C34H59N5O8 |
| Molecular Weight | 665.87 g/mol |
| Exact Mass | 665.44 |
| IUPAC Name | N-[2-[bis(3-oxobutyl)amino]ethyl]-3-[[3-[2-[bis(3-oxobutyl)amino]ethylamino]-3-oxopropyl]-[2-(2-but-3-ynoxyethoxy)ethyl]amino]propanamide |
| SMILES | C#CCCOCCOCCN(CCC(=O)NCCN(CCC(C)=O)CCC(C)=O)CCC(=O)NCCN(CCC(C)=O)CCC(C)=O |
| InChI | InChI=1S/C34H59N5O8/c1-6-7-25-46-27-28-47-26-24-39(20-12-33(44)35-14-22-37(16-8-29(2)40)17-9-30(3)41)21-13-34(45)36-15-23-38(18-10-31(4)42)19-11-32(5)43/h1H,7-28H2,2-5H3,(H,35,44)(H,36,45) |
| InChIKey | GUEHNCOKJRKPKB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.87 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|