C10H21NO3 — CID 60649279
4-[bis(2-methoxyethyl)amino]butan-2-one (PubChem CID 60649279) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)amino]butan-2-one.
| Compound Name | 4-[bis(2-methoxyethyl)amino]butan-2-one |
|---|---|
| PubChem CID | 60649279 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 4-[bis(2-methoxyethyl)amino]butan-2-one |
| SMILES | COCCN(CCOC)CCC(C)=O |
| InChI | InChI=1S/C10H21NO3/c1-10(12)4-5-11(6-8-13-2)7-9-14-3/h4-9H2,1-3H3 |
| InChIKey | DCMKGXZZGZYFEB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |