C11H24N2O4 — CID 166790089
3-[2-[bis(2-methoxyethyl)amino]ethylamino]propanoic acid (PubChem CID 166790089) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-[2-[bis(2-methoxyethyl)amino]ethylamino]propanoic acid.
| Compound Name | 3-[2-[bis(2-methoxyethyl)amino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 166790089 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-[2-[bis(2-methoxyethyl)amino]ethylamino]propanoic acid |
| SMILES | COCCN(CCNCCC(=O)O)CCOC |
| InChI | InChI=1S/C11H24N2O4/c1-16-9-7-13(8-10-17-2)6-5-12-4-3-11(14)15/h12H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | DGJYISQZOBYRPS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|