C12H27N3O4S — CID 145415868
3-[2-[2-[propyl(2-sulfinoethyl)amino]ethylamino]ethylamino]propanoic acid (PubChem CID 145415868) has the molecular formula C12H27N3O4S and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-[2-[2-[propyl(2-sulfinoethyl)amino]ethylamino]ethylamino]propanoic acid.
| Compound Name | 3-[2-[2-[propyl(2-sulfinoethyl)amino]ethylamino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 145415868 |
| Molecular Formula | C12H27N3O4S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-[2-[2-[propyl(2-sulfinoethyl)amino]ethylamino]ethylamino]propanoic acid |
| SMILES | CCCN(CCNCCNCCC(=O)O)CCS(=O)O |
| InChI | InChI=1S/C12H27N3O4S/c1-2-8-15(10-11-20(18)19)9-7-14-6-5-13-4-3-12(16)17/h13-14H,2-11H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | TTWNBVDUYHYIOA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|