C11H25N3O3S — CID 145415847
3-[2-[2-[ethyl(2-hydroxysulfanylethyl)amino]ethylamino]ethylamino]propanoic acid (PubChem CID 145415847) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is 3-[2-[2-[ethyl(2-hydroxysulfanylethyl)amino]ethylamino]ethylamino]propanoic acid.
| Compound Name | 3-[2-[2-[ethyl(2-hydroxysulfanylethyl)amino]ethylamino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 145415847 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[2-[2-[ethyl(2-hydroxysulfanylethyl)amino]ethylamino]ethylamino]propanoic acid |
| SMILES | CCN(CCNCCNCCC(=O)O)CCSO |
| InChI | InChI=1S/C11H25N3O3S/c1-2-14(9-10-18-17)8-7-13-6-5-12-4-3-11(15)16/h12-13,17H,2-10H2,1H3,(H,15,16) |
| InChIKey | UOGLTCYHMIJXQL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|