C11H22N2O2 — CID 62560104
N',N'-bis(2-methoxyethyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 62560104) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N',N'-bis(2-methoxyethyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | N',N'-bis(2-methoxyethyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 62560104 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N',N'-bis(2-methoxyethyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNCCN(CCOC)CCOC |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-12-6-7-13(8-10-14-2)9-11-15-3/h1,12H,5-11H2,2-3H3 |
| InChIKey | KGHMJCIZBWLKKN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|