C12H29N3O — CID 62574418
N'-[2-(dimethylamino)ethyl]-N-(2-methoxyethyl)-N'-propylethane-1,2-diamine (PubChem CID 62574418) has the molecular formula C12H29N3O and a molecular weight of 231.38 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N-(2-methoxyethyl)-N'-propylethane-1,2-diamine.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N-(2-methoxyethyl)-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 62574418 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N-(2-methoxyethyl)-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCNCCOC)CCN(C)C |
| InChI | InChI=1S/C12H29N3O/c1-5-8-15(11-10-14(2)3)9-6-13-7-12-16-4/h13H,5-12H2,1-4H3 |
| InChIKey | ZINSYJUAPVLQNE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|