C14H32N2O3 — CID 62559728
N-(2-butoxyethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 62559728) has the molecular formula C14H32N2O3 and a molecular weight of 276.42 g/mol. Its IUPAC name is N-(2-butoxyethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N-(2-butoxyethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62559728 |
| Molecular Formula | C14H32N2O3 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | N-(2-butoxyethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCCCOCCNCCN(CCOC)CCOC |
| InChI | InChI=1S/C14H32N2O3/c1-4-5-11-19-12-7-15-6-8-16(9-13-17-2)10-14-18-3/h15H,4-14H2,1-3H3 |
| InChIKey | RHTUYPCBCVDVIG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|