C11H26IN3O — CID 166766087
N'-butyl-N'-[2-(iodoamino)ethyl]-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 166766087) has the molecular formula C11H26IN3O and a molecular weight of 343.25 g/mol. Its IUPAC name is N'-butyl-N'-[2-(iodoamino)ethyl]-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-butyl-N'-[2-(iodoamino)ethyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166766087 |
| Molecular Formula | C11H26IN3O |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N'-butyl-N'-[2-(iodoamino)ethyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCCCN(CCNI)CCNCCOC |
| InChI | InChI=1S/C11H26IN3O/c1-3-4-8-15(10-6-14-12)9-5-13-7-11-16-2/h13-14H,3-11H2,1-2H3 |
| InChIKey | ATIBWLULDPKIEL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|