C12H29N3 — CID 58312291
N'-butyl-N-methyl-N'-[2-(propylamino)ethyl]ethane-1,2-diamine (PubChem CID 58312291) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is N'-butyl-N-methyl-N'-[2-(propylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-butyl-N-methyl-N'-[2-(propylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58312291 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | N'-butyl-N-methyl-N'-[2-(propylamino)ethyl]ethane-1,2-diamine |
| SMILES | CCCCN(CCNC)CCNCCC |
| InChI | InChI=1S/C12H29N3/c1-4-6-10-15(11-8-13-3)12-9-14-7-5-2/h13-14H,4-12H2,1-3H3 |
| InChIKey | IRYNGXGNSLJWCZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|