C11H29N5 — CID 20736880
N'-[2-[bis[2-(methylamino)ethyl]amino]ethyl]-N-methylethane-1,2-diamine (PubChem CID 20736880) has the molecular formula C11H29N5 and a molecular weight of 231.39 g/mol. Its IUPAC name is N'-[2-[bis[2-(methylamino)ethyl]amino]ethyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-[bis[2-(methylamino)ethyl]amino]ethyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 20736880 |
| Molecular Formula | C11H29N5 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.24 |
| IUPAC Name | N'-[2-[bis[2-(methylamino)ethyl]amino]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCN(CCNC)CCNC |
| InChI | InChI=1S/C11H29N5/c1-12-4-5-15-8-11-16(9-6-13-2)10-7-14-3/h12-15H,4-11H2,1-3H3 |
| InChIKey | ZNEXVZCXBPSNKL-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|