C15H36N4 — CID 122700758
N-propyl-N',N'-bis[2-(propylamino)ethyl]ethane-1,2-diamine (PubChem CID 122700758) has the molecular formula C15H36N4 and a molecular weight of 272.48 g/mol. Its IUPAC name is N-propyl-N',N'-bis[2-(propylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N-propyl-N',N'-bis[2-(propylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 122700758 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | N-propyl-N',N'-bis[2-(propylamino)ethyl]ethane-1,2-diamine |
| SMILES | CCCNCCN(CCNCCC)CCNCCC |
| InChI | InChI=1S/C15H36N4/c1-4-7-16-10-13-19(14-11-17-8-5-2)15-12-18-9-6-3/h16-18H,4-15H2,1-3H3 |
| InChIKey | USXNKZCVINXSAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|