C17H40N2O2 — CID 164907050
ethane;N'-methyl-N-[2-(2-pentoxyethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 164907050) has the molecular formula C17H40N2O2 and a molecular weight of 304.52 g/mol. Its IUPAC name is ethane;N'-methyl-N-[2-(2-pentoxyethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | ethane;N'-methyl-N-[2-(2-pentoxyethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 164907050 |
| Molecular Formula | C17H40N2O2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | ethane;N'-methyl-N-[2-(2-pentoxyethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC.CCCCCOCCOCCNCCN(C)C(C)C |
| InChI | InChI=1S/C15H34N2O2.C2H6/c1-5-6-7-11-18-13-14-19-12-9-16-8-10-17(4)15(2)3;1-2/h15-16H,5-14H2,1-4H3;1-2H3 |
| InChIKey | DNQJRLYCSWMJMW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|