C18H40N2 — CID 63492456
N-dodecyl-N'-methyl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 63492456) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N-dodecyl-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-dodecyl-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63492456 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N-dodecyl-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CCCCCCCCCCCCNCCN(C)C(C)C |
| InChI | InChI=1S/C18H40N2/c1-5-6-7-8-9-10-11-12-13-14-15-19-16-17-20(4)18(2)3/h18-19H,5-17H2,1-4H3 |
| InChIKey | QOAAWSLITZMWEI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|