C11H24N2O2 — CID 103339442
N,N'-bis(2-methoxyethyl)-N'-prop-2-enylethane-1,2-diamine (PubChem CID 103339442) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N,N'-bis(2-methoxyethyl)-N'-prop-2-enylethane-1,2-diamine.
| Compound Name | N,N'-bis(2-methoxyethyl)-N'-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 103339442 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N,N'-bis(2-methoxyethyl)-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(CCNCCOC)CCOC |
| InChI | InChI=1S/C11H24N2O2/c1-4-7-13(9-11-15-3)8-5-12-6-10-14-2/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | YOUDEHPWMHEFAQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|