C9H20N2O — CID 103339366
N'-(2-methoxyethyl)-N'-prop-2-enylpropane-1,3-diamine (PubChem CID 103339366) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-prop-2-enylpropane-1,3-diamine.
| Compound Name | N'-(2-methoxyethyl)-N'-prop-2-enylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103339366 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-prop-2-enylpropane-1,3-diamine |
| SMILES | C=CCN(CCCN)CCOC |
| InChI | InChI=1S/C9H20N2O/c1-3-6-11(7-4-5-10)8-9-12-2/h3H,1,4-10H2,2H3 |
| InChIKey | MIKOMKFMMMXVER-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|