C20H39N7O10 — CID 123609060
2-[2-[2-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate (PubChem CID 123609060) has the molecular formula C20H39N7O10 and a molecular weight of 537.57 g/mol. Its IUPAC name is 2-[2-[2-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate.
| Compound Name | 2-[2-[2-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate |
|---|---|
| PubChem CID | 123609060 |
| Molecular Formula | C20H39N7O10 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 2-[2-[2-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCC(=O)NCCOCCOCCOCCOC(=O)NNN |
| InChI | InChI=1S/C20H39N7O10/c1-20(2,3)37-18(31)25-14-17(30)24-13-16(29)23-12-15(28)22-4-5-33-6-7-34-8-9-35-10-11-36-19(32)26-27-21/h27H,4-14,21H2,1-3H3,(H,22,28)(H,23,29)(H,24,30)(H,25,31)(H,26,32) |
| InChIKey | WMCHRFRFNWEDOZ-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 229.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|