C12H23N5O6 — CID 135302900
2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]ethyl N-aminocarbamate (PubChem CID 135302900) has the molecular formula C12H23N5O6 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]ethyl N-aminocarbamate.
| Compound Name | 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]ethyl N-aminocarbamate |
|---|---|
| PubChem CID | 135302900 |
| Molecular Formula | C12H23N5O6 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]ethyl N-aminocarbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCCOC(=O)NN |
| InChI | InChI=1S/C12H23N5O6/c1-12(2,3)23-10(20)16-7-9(19)15-6-8(18)14-4-5-22-11(21)17-13/h4-7,13H2,1-3H3,(H,14,18)(H,15,19)(H,16,20)(H,17,21) |
| InChIKey | VBOLWSRMJFTPFH-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|