C8H15ClN2O2 — CID 63308286
4-chloro-N-[3-(methylamino)-3-oxopropyl]butanamide (PubChem CID 63308286) has the molecular formula C8H15ClN2O2 and a molecular weight of 206.67 g/mol. Its IUPAC name is 4-chloro-N-[3-(methylamino)-3-oxopropyl]butanamide.
| Compound Name | 4-chloro-N-[3-(methylamino)-3-oxopropyl]butanamide |
|---|---|
| PubChem CID | 63308286 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-chloro-N-[3-(methylamino)-3-oxopropyl]butanamide |
| SMILES | CNC(=O)CCNC(=O)CCCCl |
| InChI | InChI=1S/C8H15ClN2O2/c1-10-7(12)4-6-11-8(13)3-2-5-9/h2-6H2,1H3,(H,10,12)(H,11,13) |
| InChIKey | XHHKBHFDHTVNRD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|