About N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen
N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen (PubChem CID 155596032) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen.
Molecular Properties
| Compound Name | N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen |
| PubChem CID | 155596032 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen |
| SMILES | CNC(=O)CCCCC(=O)NCCO.[H][H] |
| InChI | InChI=1S/C9H18N2O3.H2/c1-10-8(13)4-2-3-5-9(14)11-6-7-12;/h12H,2-7H2,1H3,(H,10,13)(H,11,14);1H |
| InChIKey | KVOAYNHUXYHXMX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen?
The IUPAC name of N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen (CID 155596032) is N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen.
What is the SMILES notation for N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen?
The canonical SMILES for N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen is CNC(=O)CCCCC(=O)NCCO.[H][H].
What is the InChIKey of N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen?
The InChIKey is KVOAYNHUXYHXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3.H2/c1-10-8(13)4-2-3-5-9(14)11-6-7-12;/h12H,2-7H2,1H3,(H,10,13)(H,11,14);1H.
What are the key properties of N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen?
N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen has a molecular weight of 204.27 g/mol, XLogP of -0.35, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-hydroxyethyl)-N-methylhexanediamide;molecular hydrogen is sourced from PubChem (CID 155596032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).