About dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide
dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide (PubChem CID 155596071) has the molecular formula C14H27DyN2O3S-
and a molecular weight of 465.95 g/mol. Its IUPAC name is dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide.
Molecular Properties
| Compound Name | dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide |
| PubChem CID | 155596071 |
| Molecular Formula | C14H27DyN2O3S- |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide |
| SMILES | O=C(CCCCCCCCCCC(=O)NCCO)N[S-].[Dy] |
| InChI | InChI=1S/C14H27N2O3S.Dy/c17-12-11-15-13(18)9-7-5-3-1-2-4-6-8-10-14(19)16-20;/h17H,1-12H2,(H2-,15,16,18,19,20);/q-1; |
| InChIKey | YULITPBJUXGOET-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide?
The IUPAC name of dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide (CID 155596071) is dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide.
What is the SMILES notation for dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide?
The canonical SMILES for dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide is O=C(CCCCCCCCCCC(=O)NCCO)N[S-].[Dy].
What is the InChIKey of dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide?
The InChIKey is YULITPBJUXGOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2O3S.Dy/c17-12-11-15-13(18)9-7-5-3-1-2-4-6-8-10-14(19)16-20;/h17H,1-12H2,(H2-,15,16,18,19,20);/q-1;.
What are the key properties of dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide?
dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide has a molecular weight of 465.95 g/mol, XLogP of 1.57, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dysprosium;N-(2-hydroxyethyl)-N'-sulfidododecanediamide is sourced from PubChem (CID 155596071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).