About (E)-N'-(2-hydroxyethyl)octadec-9-enediamide
(E)-N'-(2-hydroxyethyl)octadec-9-enediamide (PubChem CID 87767010) has the molecular formula C20H38N2O3
and a molecular weight of 354.54 g/mol. Its IUPAC name is (E)-N'-(2-hydroxyethyl)octadec-9-enediamide.
Molecular Properties
| Compound Name | (E)-N'-(2-hydroxyethyl)octadec-9-enediamide |
| PubChem CID | 87767010 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (E)-N'-(2-hydroxyethyl)octadec-9-enediamide |
| SMILES | NC(=O)CCCCCCC/C=C/CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C20H38N2O3/c21-19(24)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-20(25)22-17-18-23/h1-2,23H,3-18H2,(H2,21,24)(H,22,25)/b2-1+ |
| InChIKey | IGEGKRVQOOQUHK-OWOJBTEDSA-N |
| XLogP | 3.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(2-hydroxyethyl)octadec-9-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(2-hydroxyethyl)octadec-9-enediamide?
The IUPAC name of (E)-N'-(2-hydroxyethyl)octadec-9-enediamide (CID 87767010) is (E)-N'-(2-hydroxyethyl)octadec-9-enediamide.
What is the SMILES notation for (E)-N'-(2-hydroxyethyl)octadec-9-enediamide?
The canonical SMILES for (E)-N'-(2-hydroxyethyl)octadec-9-enediamide is NC(=O)CCCCCCC/C=C/CCCCCCCC(=O)NCCO.
What is the InChIKey of (E)-N'-(2-hydroxyethyl)octadec-9-enediamide?
The InChIKey is IGEGKRVQOOQUHK-OWOJBTEDSA-N. The full InChI is InChI=1S/C20H38N2O3/c21-19(24)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-20(25)22-17-18-23/h1-2,23H,3-18H2,(H2,21,24)(H,22,25)/b2-1+.
What are the key properties of (E)-N'-(2-hydroxyethyl)octadec-9-enediamide?
(E)-N'-(2-hydroxyethyl)octadec-9-enediamide has a molecular weight of 354.54 g/mol, XLogP of 3.60, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(2-hydroxyethyl)octadec-9-enediamide is sourced from PubChem (CID 87767010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).