About 2-(methylamino)ethanol;N-methyl-6-oxohexanamide
2-(methylamino)ethanol;N-methyl-6-oxohexanamide (PubChem CID 155596118) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(methylamino)ethanol;N-methyl-6-oxohexanamide.
Molecular Properties
| Compound Name | 2-(methylamino)ethanol;N-methyl-6-oxohexanamide |
| PubChem CID | 155596118 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(methylamino)ethanol;N-methyl-6-oxohexanamide |
| SMILES | CNC(=O)CCCCC=O.CNCCO |
| InChI | InChI=1S/C7H13NO2.C3H9NO/c1-8-7(10)5-3-2-4-6-9;1-4-2-3-5/h6H,2-5H2,1H3,(H,8,10);4-5H,2-3H2,1H3 |
| InChIKey | KCPGPFILROKUNN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethanol;N-methyl-6-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethanol;N-methyl-6-oxohexanamide?
The IUPAC name of 2-(methylamino)ethanol;N-methyl-6-oxohexanamide (CID 155596118) is 2-(methylamino)ethanol;N-methyl-6-oxohexanamide.
What is the SMILES notation for 2-(methylamino)ethanol;N-methyl-6-oxohexanamide?
The canonical SMILES for 2-(methylamino)ethanol;N-methyl-6-oxohexanamide is CNC(=O)CCCCC=O.CNCCO.
What is the InChIKey of 2-(methylamino)ethanol;N-methyl-6-oxohexanamide?
The InChIKey is KCPGPFILROKUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C3H9NO/c1-8-7(10)5-3-2-4-6-9;1-4-2-3-5/h6H,2-5H2,1H3,(H,8,10);4-5H,2-3H2,1H3.
What are the key properties of 2-(methylamino)ethanol;N-methyl-6-oxohexanamide?
2-(methylamino)ethanol;N-methyl-6-oxohexanamide has a molecular weight of 218.30 g/mol, XLogP of -0.31, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethanol;N-methyl-6-oxohexanamide is sourced from PubChem (CID 155596118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).