C9H17N3O3 — CID 10680195
N-methyl-N'-[3-(methylamino)-3-oxopropyl]butanediamide (PubChem CID 10680195) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is N-methyl-N'-[3-(methylamino)-3-oxopropyl]butanediamide.
| Compound Name | N-methyl-N'-[3-(methylamino)-3-oxopropyl]butanediamide |
|---|---|
| PubChem CID | 10680195 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-methyl-N'-[3-(methylamino)-3-oxopropyl]butanediamide |
| SMILES | CNC(=O)CCNC(=O)CCC(=O)NC |
| InChI | InChI=1S/C9H17N3O3/c1-10-7(13)3-4-9(15)12-6-5-8(14)11-2/h3-6H2,1-2H3,(H,10,13)(H,11,14)(H,12,15) |
| InChIKey | WXRVGVJIDYVOBL-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |