C4H9ClN2O — CID 12559346
2-chloro-N',N'-dimethylacetohydrazide (PubChem CID 12559346) has the molecular formula C4H9ClN2O and a molecular weight of 136.58 g/mol. Its IUPAC name is 2-chloro-N',N'-dimethylacetohydrazide.
| Compound Name | 2-chloro-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 12559346 |
| Molecular Formula | C4H9ClN2O |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2-chloro-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)CCl |
| InChI | InChI=1S/C4H9ClN2O/c1-7(2)6-4(8)3-5/h3H2,1-2H3,(H,6,8) |
| InChIKey | KUZAASWDHYLWAF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|