C8H19N3O — CID 83021084
3-(ethylamino)-N',N'-dimethylbutanehydrazide (PubChem CID 83021084) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-(ethylamino)-N',N'-dimethylbutanehydrazide.
| Compound Name | 3-(ethylamino)-N',N'-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 83021084 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 3-(ethylamino)-N',N'-dimethylbutanehydrazide |
| SMILES | CCNC(C)CC(=O)NN(C)C |
| InChI | InChI=1S/C8H19N3O/c1-5-9-7(2)6-8(12)10-11(3)4/h7,9H,5-6H2,1-4H3,(H,10,12) |
| InChIKey | CVOGCBHQHLDDPY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|