C6H14N4O2 — CID 7039174
1-N',1-N',2-N',2-N'-tetramethylethanedihydrazide (PubChem CID 7039174) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-N',1-N',2-N',2-N'-tetramethylethanedihydrazide.
| Compound Name | 1-N',1-N',2-N',2-N'-tetramethylethanedihydrazide |
|---|---|
| PubChem CID | 7039174 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-N',1-N',2-N',2-N'-tetramethylethanedihydrazide |
| SMILES | CN(C)NC(=O)C(=O)NN(C)C |
| InChI | InChI=1S/C6H14N4O2/c1-9(2)7-5(11)6(12)8-10(3)4/h1-4H3,(H,7,11)(H,8,12) |
| InChIKey | DWMVRSJYMGXBKL-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|