C8H18N2O — CID 20658367
N',N',2,3-tetramethylbutanehydrazide (PubChem CID 20658367) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is N',N',2,3-tetramethylbutanehydrazide.
| Compound Name | N',N',2,3-tetramethylbutanehydrazide |
|---|---|
| PubChem CID | 20658367 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N',N',2,3-tetramethylbutanehydrazide |
| SMILES | CC(C)C(C)C(=O)NN(C)C |
| InChI | InChI=1S/C8H18N2O/c1-6(2)7(3)8(11)9-10(4)5/h6-7H,1-5H3,(H,9,11) |
| InChIKey | LRIRDTTXWXOZPR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|