C8H17NO3S — CID 161158592
2-[[(2R)-2,3-dimethylbutanoyl]amino]acetic acid;sulfane (PubChem CID 161158592) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-[[(2R)-2,3-dimethylbutanoyl]amino]acetic acid;sulfane.
| Compound Name | 2-[[(2R)-2,3-dimethylbutanoyl]amino]acetic acid;sulfane |
|---|---|
| PubChem CID | 161158592 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-[[(2R)-2,3-dimethylbutanoyl]amino]acetic acid;sulfane |
| SMILES | CC(C)[C@@H](C)C(=O)NCC(=O)O.S |
| InChI | InChI=1S/C8H15NO3.H2S/c1-5(2)6(3)8(12)9-4-7(10)11;/h5-6H,4H2,1-3H3,(H,9,12)(H,10,11);1H2/t6-;/m1./s1 |
| InChIKey | UPPWWWZCFWMJLD-FYZOBXCZSA-N |
| XLogP | 0.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |