C5H8NO3STl — CID 145330840
[1-(carboxymethylamino)-1-oxopropan-2-yl]sulfanylthallium (PubChem CID 145330840) has the molecular formula C5H8NO3STl and a molecular weight of 366.57 g/mol. Its IUPAC name is [1-(carboxymethylamino)-1-oxopropan-2-yl]sulfanylthallium.
| Compound Name | [1-(carboxymethylamino)-1-oxopropan-2-yl]sulfanylthallium |
|---|---|
| PubChem CID | 145330840 |
| Molecular Formula | C5H8NO3STl |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | [1-(carboxymethylamino)-1-oxopropan-2-yl]sulfanylthallium |
| SMILES | CC(S[Tl])C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9NO3S.Tl/c1-3(10)5(9)6-2-4(7)8;/h3,10H,2H2,1H3,(H,6,9)(H,7,8);/q;+1/p-1 |
| InChIKey | BTRNFHQWHSJDQT-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |