C11H18N2O6S2 — CID 130279737
3-[2-[[1-(carboxymethylamino)-1-oxopropan-2-yl]disulfanyl]propanoylamino]propanoic acid (PubChem CID 130279737) has the molecular formula C11H18N2O6S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[2-[[1-(carboxymethylamino)-1-oxopropan-2-yl]disulfanyl]propanoylamino]propanoic acid.
| Compound Name | 3-[2-[[1-(carboxymethylamino)-1-oxopropan-2-yl]disulfanyl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 130279737 |
| Molecular Formula | C11H18N2O6S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-[2-[[1-(carboxymethylamino)-1-oxopropan-2-yl]disulfanyl]propanoylamino]propanoic acid |
| SMILES | CC(SSC(C)C(=O)NCC(=O)O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C11H18N2O6S2/c1-6(10(18)12-4-3-8(14)15)20-21-7(2)11(19)13-5-9(16)17/h6-7H,3-5H2,1-2H3,(H,12,18)(H,13,19)(H,14,15)(H,16,17) |
| InChIKey | WBLYKHAZNFRDJN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|