C5H8N2O4S — CID 100944735
2-(2-nitrososulfanylpropanoylamino)acetic acid (PubChem CID 100944735) has the molecular formula C5H8N2O4S and a molecular weight of 193.19 g/mol. Its IUPAC name is 2-(2-nitrososulfanylpropanoylamino)acetic acid.
| Compound Name | 2-(2-nitrososulfanylpropanoylamino)acetic acid |
|---|---|
| PubChem CID | 100944735 |
| Molecular Formula | C5H8N2O4S |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 2-(2-nitrososulfanylpropanoylamino)acetic acid |
| SMILES | CC(S[15N]=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H8N2O4S/c1-3(12-7-11)5(10)6-2-4(8)9/h3H,2H2,1H3,(H,6,10)(H,8,9)/i7+1 |
| InChIKey | GKNGRGKVTQTYRI-CDYZYAPPSA-N |
| XLogP | -0.01 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|