C11H19NO4S — CID 166142767
2-[2-(4-methylpentanoylsulfanyl)propanoylamino]acetic acid (PubChem CID 166142767) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[2-(4-methylpentanoylsulfanyl)propanoylamino]acetic acid.
| Compound Name | 2-[2-(4-methylpentanoylsulfanyl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 166142767 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[2-(4-methylpentanoylsulfanyl)propanoylamino]acetic acid |
| SMILES | CC(C)CCC(=O)SC(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H19NO4S/c1-7(2)4-5-10(15)17-8(3)11(16)12-6-9(13)14/h7-8H,4-6H2,1-3H3,(H,12,16)(H,13,14) |
| InChIKey | SZFHLFVLLYZENQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|