C13H25N3O5 — CID 123660918
2-[2-[[1-hydroxy-2-[methyl(propanoyl)amino]butyl]amino]propanoylamino]acetic acid (PubChem CID 123660918) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[2-[[1-hydroxy-2-[methyl(propanoyl)amino]butyl]amino]propanoylamino]acetic acid.
| Compound Name | 2-[2-[[1-hydroxy-2-[methyl(propanoyl)amino]butyl]amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 123660918 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[2-[[1-hydroxy-2-[methyl(propanoyl)amino]butyl]amino]propanoylamino]acetic acid |
| SMILES | CCC(=O)N(C)C(CC)C(O)NC(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-5-9(16(4)10(17)6-2)13(21)15-8(3)12(20)14-7-11(18)19/h8-9,13,15,21H,5-7H2,1-4H3,(H,14,20)(H,18,19) |
| InChIKey | UGGDCAIOMDOPBU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|