C14H24N4O6 — CID 123649575
3-[[3-[[3-(2-carboxyethylamino)-2-methyl-3-oxopropyl]diazenyl]-2-methylpropanoyl]amino]propanoic acid (PubChem CID 123649575) has the molecular formula C14H24N4O6 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[[3-[[3-(2-carboxyethylamino)-2-methyl-3-oxopropyl]diazenyl]-2-methylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[[3-(2-carboxyethylamino)-2-methyl-3-oxopropyl]diazenyl]-2-methylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 123649575 |
| Molecular Formula | C14H24N4O6 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[[3-[[3-(2-carboxyethylamino)-2-methyl-3-oxopropyl]diazenyl]-2-methylpropanoyl]amino]propanoic acid |
| SMILES | CC(C/N=N/CC(C)C(=O)NCCC(=O)O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H24N4O6/c1-9(13(23)15-5-3-11(19)20)7-17-18-8-10(2)14(24)16-6-4-12(21)22/h9-10H,3-8H2,1-2H3,(H,15,23)(H,16,24)(H,19,20)(H,21,22)/b18-17+ |
| InChIKey | IOBGRCJZZDSOCM-ISLYRVAYSA-N |
| XLogP | -0.11 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|