C10H20N2O3 — CID 135251442
3-[2-((113C)methylamino)(5,6-13C2)hexanoylamino]propanoic acid (PubChem CID 135251442) has the molecular formula C10H20N2O3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-[2-((113C)methylamino)(5,6-13C2)hexanoylamino]propanoic acid.
| Compound Name | 3-[2-((113C)methylamino)(5,6-13C2)hexanoylamino]propanoic acid |
|---|---|
| PubChem CID | 135251442 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-[2-((113C)methylamino)(5,6-13C2)hexanoylamino]propanoic acid |
| SMILES | [13CH3][13CH2]CCC(N[13CH3])C(=O)NCCC(=O)O |
| InChI | InChI=1S/C10H20N2O3/c1-3-4-5-8(11-2)10(15)12-7-6-9(13)14/h8,11H,3-7H2,1-2H3,(H,12,15)(H,13,14)/i1+1,2+1,3+1 |
| InChIKey | XKYMNUMJZDKGQK-VMIGTVKRSA-N |
| XLogP | 0.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |