C13H27N5O4 — CID 123412371
5-[3-[[3-amino-2-(methylamino)propanoyl]amino]propylamino]-4-(methylamino)-5-oxopentanoic acid (PubChem CID 123412371) has the molecular formula C13H27N5O4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[3-[[3-amino-2-(methylamino)propanoyl]amino]propylamino]-4-(methylamino)-5-oxopentanoic acid.
| Compound Name | 5-[3-[[3-amino-2-(methylamino)propanoyl]amino]propylamino]-4-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123412371 |
| Molecular Formula | C13H27N5O4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 5-[3-[[3-amino-2-(methylamino)propanoyl]amino]propylamino]-4-(methylamino)-5-oxopentanoic acid |
| SMILES | CNC(CN)C(=O)NCCCNC(=O)C(CCC(=O)O)NC |
| InChI | InChI=1S/C13H27N5O4/c1-15-9(4-5-11(19)20)12(21)17-6-3-7-18-13(22)10(8-14)16-2/h9-10,15-16H,3-8,14H2,1-2H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | ZAQBWXAKVYAFIN-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|