C6H10INO3 — CID 118303517
(4S)-5-iodo-4-(methylamino)-5-oxopentanoic acid (PubChem CID 118303517) has the molecular formula C6H10INO3 and a molecular weight of 271.05 g/mol. Its IUPAC name is (4S)-5-iodo-4-(methylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-iodo-4-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118303517 |
| Molecular Formula | C6H10INO3 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | (4S)-5-iodo-4-(methylamino)-5-oxopentanoic acid |
| SMILES | CN[C@@H](CCC(=O)O)C(=O)I |
| InChI | InChI=1S/C6H10INO3/c1-8-4(6(7)11)2-3-5(9)10/h4,8H,2-3H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | AGDSQFVFJQGIIR-BYPYZUCNSA-N |
| XLogP | 0.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|