2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid

C8H15NO6 — CID 143106959

IUPAC2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid
SMILESCNC(CCC(=O)O)C(=O)O.O=CCO
InChIInChI=1S/C6H11NO4.C2H4O2/c1-7-4(6(10)11)2-3-5(8)9;3-1-2-4/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11);1,4H,2H2
InChIKeyMJLYRNOQNIYFBR-UHFFFAOYSA-N
MW221.21 g/mol
LogP-1.30
Rot. Bonds6

About 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid

2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid (PubChem CID 143106959) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid.

Molecular Properties

Compound Name2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid
PubChem CID143106959
Molecular FormulaC8H15NO6
Molecular Weight221.21 g/mol
Exact Mass221.09
IUPAC Name2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid
SMILESCNC(CCC(=O)O)C(=O)O.O=CCO
InChIInChI=1S/C6H11NO4.C2H4O2/c1-7-4(6(10)11)2-3-5(8)9;3-1-2-4/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11);1,4H,2H2
InChIKeyMJLYRNOQNIYFBR-UHFFFAOYSA-N
XLogP-1.30
TPSA123.93 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 5-1.30
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid?
The IUPAC name of 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid (CID 143106959) is 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid.
What is the SMILES notation for 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid?
The canonical SMILES for 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid is CNC(CCC(=O)O)C(=O)O.O=CCO.
What is the InChIKey of 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid?
The InChIKey is MJLYRNOQNIYFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4.C2H4O2/c1-7-4(6(10)11)2-3-5(8)9;3-1-2-4/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11);1,4H,2H2.
What are the key properties of 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid?
2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid has a molecular weight of 221.21 g/mol, XLogP of -1.30, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid is sourced from PubChem (CID 143106959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).