C8H15NO6 — CID 143106959
2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid (PubChem CID 143106959) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid.
| Compound Name | 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid |
|---|---|
| PubChem CID | 143106959 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-hydroxyacetaldehyde;2-(methylamino)pentanedioic acid |
| SMILES | CNC(CCC(=O)O)C(=O)O.O=CCO |
| InChI | InChI=1S/C6H11NO4.C2H4O2/c1-7-4(6(10)11)2-3-5(8)9;3-1-2-4/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11);1,4H,2H2 |
| InChIKey | MJLYRNOQNIYFBR-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|