C10H17N3O6 — CID 166852820
(4S)-5-[(1-carboxy-2-formamidoethyl)amino]-4-(methylamino)-5-oxopentanoic acid (PubChem CID 166852820) has the molecular formula C10H17N3O6 and a molecular weight of 275.26 g/mol. Its IUPAC name is (4S)-5-[(1-carboxy-2-formamidoethyl)amino]-4-(methylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-[(1-carboxy-2-formamidoethyl)amino]-4-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166852820 |
| Molecular Formula | C10H17N3O6 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (4S)-5-[(1-carboxy-2-formamidoethyl)amino]-4-(methylamino)-5-oxopentanoic acid |
| SMILES | CN[C@@H](CCC(=O)O)C(=O)NC(CNC=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c1-11-6(2-3-8(15)16)9(17)13-7(10(18)19)4-12-5-14/h5-7,11H,2-4H2,1H3,(H,12,14)(H,13,17)(H,15,16)(H,18,19)/t6-,7?/m0/s1 |
| InChIKey | HKYBAJFHXQGHEY-PKPIPKONSA-N |
| XLogP | -2.25 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|