C8H13NO6 — CID 170835683
(2S)-2-[[(2R)-2-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 170835683) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 170835683 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | C[C@@H](O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO6/c1-4(10)7(13)9-5(8(14)15)2-3-6(11)12/h4-5,10H,2-3H2,1H3,(H,9,13)(H,11,12)(H,14,15)/t4-,5+/m1/s1 |
| InChIKey | NAOMOQZOYKZXAQ-UHNVWZDZSA-N |
| XLogP | -1.20 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |