C11H20N2O5 — CID 7009625
(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]pentanedioic acid (PubChem CID 7009625) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 7009625 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-3-6(2)9(12)10(16)13-7(11(17)18)4-5-8(14)15/h6-7,9H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t6-,7-,9-/m0/s1 |
| InChIKey | KTGFOCFYOZQVRJ-ZKWXMUAHSA-N |
| XLogP | -0.21 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |