C18H28N4O11 — CID 18501865
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid (PubChem CID 18501865) has the molecular formula C18H28N4O11 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18501865 |
| Molecular Formula | C18H28N4O11 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H28N4O11/c1-3-7(2)14(19)17(31)21-9(5-12(25)26)15(29)20-8(4-11(23)24)16(30)22-10(18(32)33)6-13(27)28/h7-10,14H,3-6,19H2,1-2H3,(H,20,29)(H,21,31)(H,22,30)(H,23,24)(H,25,26)(H,27,28)(H,32,33) |
| InChIKey | IAJDTGXEQKQMLX-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 262.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |