C20H32N4O11 — CID 18502703
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 18502703) has the molecular formula C20H32N4O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18502703 |
| Molecular Formula | C20H32N4O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N4O11/c1-3-9(2)16(21)19(33)23-11(5-7-14(27)28)17(31)22-10(4-6-13(25)26)18(32)24-12(20(34)35)8-15(29)30/h9-12,16H,3-8,21H2,1-2H3,(H,22,31)(H,23,33)(H,24,32)(H,25,26)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | AELUMOLDSWPILS-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 262.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |