C22H42N6O7 — CID 18296023
2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18296023) has the molecular formula C22H42N6O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18296023 |
| Molecular Formula | C22H42N6O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H42N6O7/c1-3-13(2)18(25)21(33)27-15(9-5-7-11-24)19(31)26-14(8-4-6-10-23)20(32)28-16(22(34)35)12-17(29)30/h13-16,18H,3-12,23-25H2,1-2H3,(H,26,31)(H,27,33)(H,28,32)(H,29,30)(H,34,35) |
| InChIKey | BBDWPVFEAKIUIH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|