C20H37N5O8 — CID 18296122
2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid (PubChem CID 18296122) has the molecular formula C20H37N5O8 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18296122 |
| Molecular Formula | C20H37N5O8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C20H37N5O8/c1-4-10(2)15(22)18(30)23-12(7-5-6-8-21)17(29)25-16(11(3)26)19(31)24-13(20(32)33)9-14(27)28/h10-13,15-16,26H,4-9,21-22H2,1-3H3,(H,23,30)(H,24,31)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | JHWPQXXVIZNCAN-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|