C11H19NO5 — CID 176727519
(2S)-2-[[(2R)-2,3-dimethylbutanoyl]amino]pentanedioic acid (PubChem CID 176727519) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2,3-dimethylbutanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2,3-dimethylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 176727519 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (2S)-2-[[(2R)-2,3-dimethylbutanoyl]amino]pentanedioic acid |
| SMILES | CC(C)[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c1-6(2)7(3)10(15)12-8(11(16)17)4-5-9(13)14/h6-8H,4-5H2,1-3H3,(H,12,15)(H,13,14)(H,16,17)/t7-,8+/m1/s1 |
| InChIKey | HGHHDOWAOBEDLA-SFYZADRCSA-N |
| XLogP | 0.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |