C11H20N2O6 — CID 124797786
(2S)-2-[[(2R)-2-hydroxypropanoyl]amino]-5-[[(2S)-2-hydroxypropanoyl]amino]pentanoic acid (PubChem CID 124797786) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]-5-[[(2S)-2-hydroxypropanoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]-5-[[(2S)-2-hydroxypropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 124797786 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxypropanoyl]amino]-5-[[(2S)-2-hydroxypropanoyl]amino]pentanoic acid |
| SMILES | C[C@H](O)C(=O)NCCC[C@H](NC(=O)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O6/c1-6(14)9(16)12-5-3-4-8(11(18)19)13-10(17)7(2)15/h6-8,14-15H,3-5H2,1-2H3,(H,12,16)(H,13,17)(H,18,19)/t6-,7+,8-/m0/s1 |
| InChIKey | BNYPLFCTHFPFQZ-RNJXMRFFSA-N |
| XLogP | -1.79 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|