C15H29N5O5 — CID 87281357
(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]-5-(carbamoylamino)pentanoic acid (PubChem CID 87281357) has the molecular formula C15H29N5O5 and a molecular weight of 359.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 87281357 |
| Molecular Formula | C15H29N5O5 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]-5-(carbamoylamino)pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H29N5O5/c1-8(2)7-11(20-12(21)9(3)16)13(22)19-10(14(23)24)5-4-6-18-15(17)25/h8-11H,4-7,16H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)(H3,17,18,25)/t9-,10-,11-/m0/s1 |
| InChIKey | BOHMZNVYFPNJHL-DCAQKATOSA-N |
| XLogP | -1.12 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|